C11H12F3NO2 — CID 103213042
1-(4-aminophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103213042) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(4-aminophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103213042 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(4-aminophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | Nc1ccc(C(=O)CCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO2/c12-11(13,14)7-17-6-5-10(16)8-1-3-9(15)4-2-8/h1-4H,5-7,15H2 |
| InChIKey | MXFYGIVPNJXNLN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|