C13H14F3NO3 — CID 103206455
N-[4-[3-(2,2,2-trifluoroethoxy)propanoyl]phenyl]acetamide (PubChem CID 103206455) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[4-[3-(2,2,2-trifluoroethoxy)propanoyl]phenyl]acetamide.
| Compound Name | N-[4-[3-(2,2,2-trifluoroethoxy)propanoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 103206455 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[4-[3-(2,2,2-trifluoroethoxy)propanoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)CCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3NO3/c1-9(18)17-11-4-2-10(3-5-11)12(19)6-7-20-8-13(14,15)16/h2-5H,6-8H2,1H3,(H,17,18) |
| InChIKey | GWYUIDPETAKZSX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|