C12H11F3N2O3 — CID 22279321
N-(4-acetamidophenyl)-4,4,4-trifluoro-3-oxobutanamide (PubChem CID 22279321) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-4,4,4-trifluoro-3-oxobutanamide.
| Compound Name | N-(4-acetamidophenyl)-4,4,4-trifluoro-3-oxobutanamide |
|---|---|
| PubChem CID | 22279321 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(4-acetamidophenyl)-4,4,4-trifluoro-3-oxobutanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N2O3/c1-7(18)16-8-2-4-9(5-3-8)17-11(20)6-10(19)12(13,14)15/h2-5H,6H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | NFNNRTCZNFBJFH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|