C10H7F4NO2 — CID 11391010
4,4,4-trifluoro-N-(3-fluorophenyl)-3-oxobutanamide (PubChem CID 11391010) has the molecular formula C10H7F4NO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(3-fluorophenyl)-3-oxobutanamide.
| Compound Name | 4,4,4-trifluoro-N-(3-fluorophenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 11391010 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4,4,4-trifluoro-N-(3-fluorophenyl)-3-oxobutanamide |
| SMILES | O=C(CC(=O)C(F)(F)F)Nc1cccc(F)c1 |
| InChI | InChI=1S/C10H7F4NO2/c11-6-2-1-3-7(4-6)15-9(17)5-8(16)10(12,13)14/h1-4H,5H2,(H,15,17) |
| InChIKey | RYSVTLONGDMNCU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|