C15H19F3N2O2 — CID 70069905
N-(4-aminophenyl)-9,9,9-trifluoro-8-oxononanamide (PubChem CID 70069905) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is N-(4-aminophenyl)-9,9,9-trifluoro-8-oxononanamide.
| Compound Name | N-(4-aminophenyl)-9,9,9-trifluoro-8-oxononanamide |
|---|---|
| PubChem CID | 70069905 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(4-aminophenyl)-9,9,9-trifluoro-8-oxononanamide |
| SMILES | Nc1ccc(NC(=O)CCCCCCC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O2/c16-15(17,18)13(21)5-3-1-2-4-6-14(22)20-12-9-7-11(19)8-10-12/h7-10H,1-6,19H2,(H,20,22) |
| InChIKey | BLQSSIULAFOGDY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|