C9H10BF3O4 — CID 106705303
[4-(2,2,2-trifluoroethoxymethoxy)phenyl]boronic acid (PubChem CID 106705303) has the molecular formula C9H10BF3O4 and a molecular weight of 249.98 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxymethoxy)phenyl]boronic acid.
| Compound Name | [4-(2,2,2-trifluoroethoxymethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 106705303 |
| Molecular Formula | C9H10BF3O4 |
| Molecular Weight | 249.98 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxymethoxy)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H10BF3O4/c11-9(12,13)5-16-6-17-8-3-1-7(2-4-8)10(14)15/h1-4,14-15H,5-6H2 |
| InChIKey | CRECKVRXWYDFJL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.98 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|