C13H13F3O3 — CID 106705542
4-[4-(2,2,2-trifluoroethoxymethoxy)phenyl]but-3-yn-1-ol (PubChem CID 106705542) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroethoxymethoxy)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(2,2,2-trifluoroethoxymethoxy)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 106705542 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroethoxymethoxy)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccc(OCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3O3/c14-13(15,16)9-18-10-19-12-6-4-11(5-7-12)3-1-2-8-17/h4-7,17H,2,8-10H2 |
| InChIKey | OKLSLMABHMNHPO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|