C14H14F3NO3 — CID 103209883
N-[4-(4-hydroxybut-1-ynyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103209883) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is N-[4-(4-hydroxybut-1-ynyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[4-(4-hydroxybut-1-ynyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103209883 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[4-(4-hydroxybut-1-ynyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)Nc1ccc(C#CCCO)cc1 |
| InChI | InChI=1S/C14H14F3NO3/c15-14(16,17)10-21-9-13(20)18-12-6-4-11(5-7-12)3-1-2-8-19/h4-7,19H,2,8-10H2,(H,18,20) |
| InChIKey | SPWJVVSGZOWXJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|