C14H19F3N2O2 — CID 106910317
N-[4-(propylaminomethyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 106910317) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[4-(propylaminomethyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[4-(propylaminomethyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 106910317 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[4-(propylaminomethyl)phenyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CCCNCc1ccc(NC(=O)COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-7-18-8-11-3-5-12(6-4-11)19-13(20)9-21-10-14(15,16)17/h3-6,18H,2,7-10H2,1H3,(H,19,20) |
| InChIKey | GGBQWJUCZQWTQR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|