C11H13F3N2O4S — CID 87002433
N-(4-methyl-3-sulfamoylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 87002433) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 87002433 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | Cc1ccc(NC(=O)COCC(F)(F)F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7-2-3-8(4-9(7)21(15,18)19)16-10(17)5-20-6-11(12,13)14/h2-4H,5-6H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | XHMCUAXJSRHNPG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |