C18H21N3O4S2 — CID 9141188
N-(4-methylphenyl)-2-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]sulfanylacetamide (PubChem CID 9141188) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-methylphenyl)-2-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9141188 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-(4-methylphenyl)-2-[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)Nc2ccc(C)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-12-3-6-14(7-4-12)20-17(22)10-26-11-18(23)21-15-8-5-13(2)16(9-15)27(19,24)25/h3-9H,10-11H2,1-2H3,(H,20,22)(H,21,23)(H2,19,24,25) |
| InChIKey | RQRZYAXWOVAVRZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |