C13H17F3N2O4S — CID 134005218
N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 134005218) has the molecular formula C13H17F3N2O4S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 134005218 |
| Molecular Formula | C13H17F3N2O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)CCOCC(F)(F)F)ccc1C |
| InChI | InChI=1S/C13H17F3N2O4S/c1-9-3-4-10(7-11(9)23(20,21)17-2)18-12(19)5-6-22-8-13(14,15)16/h3-4,7,17H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | CNYKPTMGNZGEPL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|