C15H20N2O6S — CID 9199194
[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 4-oxopentanoate (PubChem CID 9199194) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 9199194 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 4-oxopentanoate |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)COC(=O)CCC(C)=O)ccc1C |
| InChI | InChI=1S/C15H20N2O6S/c1-10-4-6-12(8-13(10)24(21,22)16-3)17-14(19)9-23-15(20)7-5-11(2)18/h4,6,8,16H,5,7,9H2,1-3H3,(H,17,19) |
| InChIKey | AOEVJFBYGJTCQD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |