C20H24N2O6S — CID 8578282
[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 3-(3-methylphenoxy)propanoate (PubChem CID 8578282) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 3-(3-methylphenoxy)propanoate.
| Compound Name | [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 3-(3-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 8578282 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl] 3-(3-methylphenoxy)propanoate |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)COC(=O)CCOc2cccc(C)c2)ccc1C |
| InChI | InChI=1S/C20H24N2O6S/c1-14-5-4-6-17(11-14)27-10-9-20(24)28-13-19(23)22-16-8-7-15(2)18(12-16)29(25,26)21-3/h4-8,11-12,21H,9-10,13H2,1-3H3,(H,22,23) |
| InChIKey | VSUHGRMFPJZIER-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |