C19H24N2O4S — CID 9107112
N-[4-methyl-3-(methylsulfamoyl)phenyl]-4-(4-methylphenoxy)butanamide (PubChem CID 9107112) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 9107112 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]-4-(4-methylphenoxy)butanamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)CCCOc2ccc(C)cc2)ccc1C |
| InChI | InChI=1S/C19H24N2O4S/c1-14-6-10-17(11-7-14)25-12-4-5-19(22)21-16-9-8-15(2)18(13-16)26(23,24)20-3/h6-11,13,20H,4-5,12H2,1-3H3,(H,21,22) |
| InChIKey | CBKWNQAWIUEEFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|