C19H26ClN3O4S — CID 119264847
4-amino-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]butanamide;hydrochloride (PubChem CID 119264847) has the molecular formula C19H26ClN3O4S and a molecular weight of 427.95 g/mol. Its IUPAC name is 4-amino-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119264847 |
| Molecular Formula | C19H26ClN3O4S |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-amino-N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methylphenyl]butanamide;hydrochloride |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)CCCN)ccc2C)cc1.Cl |
| InChI | InChI=1S/C19H25N3O4S.ClH/c1-3-26-17-10-8-15(9-11-17)22-27(24,25)18-13-16(7-6-14(18)2)21-19(23)5-4-12-20;/h6-11,13,22H,3-5,12,20H2,1-2H3,(H,21,23);1H |
| InChIKey | PZGXXAGKZGYCRT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |