C17H25N3O6S — CID 56520446
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(4-methylpentanoylamino)acetate (PubChem CID 56520446) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(4-methylpentanoylamino)acetate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(4-methylpentanoylamino)acetate |
|---|---|
| PubChem CID | 56520446 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(4-methylpentanoylamino)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CNC(=O)CCC(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H25N3O6S/c1-11(2)4-7-15(21)19-9-17(23)26-10-16(22)20-13-6-5-12(3)14(8-13)27(18,24)25/h5-6,8,11H,4,7,9-10H2,1-3H3,(H,19,21)(H,20,22)(H2,18,24,25) |
| InChIKey | LWWYCEBSUTWRTR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |