C18H21N3O7S2 — CID 55365933
[2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate (PubChem CID 55365933) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate.
| Compound Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55365933 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [2-(4-methyl-3-sulfamoylanilino)-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C(C)NS(=O)(=O)c2ccccc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C18H21N3O7S2/c1-12-8-9-14(10-16(12)29(19,24)25)20-17(22)11-28-18(23)13(2)21-30(26,27)15-6-4-3-5-7-15/h3-10,13,21H,11H2,1-2H3,(H,20,22)(H2,19,24,25) |
| InChIKey | LCDVDPZCTBLCGN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |