C27H24N2O7S — CID 3298855
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)-3-methylbutanoate (PubChem CID 3298855) has the molecular formula C27H24N2O7S and a molecular weight of 520.56 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)-3-methylbutanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
|---|---|
| PubChem CID | 3298855 |
| Molecular Formula | C27H24N2O7S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H24N2O7S/c1-16(2)24(29-37(34,35)18-8-4-3-5-9-18)27(33)36-15-23(30)28-17-12-13-21-22(14-17)26(32)20-11-7-6-10-19(20)25(21)31/h3-14,16,24,29H,15H2,1-2H3,(H,28,30) |
| InChIKey | HZLBTQMHPBDEGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|