C25H26N2O5S2 — CID 4543099
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate (PubChem CID 4543099) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
|---|---|
| PubChem CID | 4543099 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 2-(benzenesulfonamido)-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C25H26N2O5S2/c1-18(2)24(27-34(30,31)20-13-7-4-8-14-20)25(29)32-17-23(28)26-21-15-9-10-16-22(21)33-19-11-5-3-6-12-19/h3-16,18,24,27H,17H2,1-2H3,(H,26,28) |
| InChIKey | BCULEMHKRNILCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |