C29H26N2O6 — CID 55926505
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(3-methylbenzoyl)amino]butanoate (PubChem CID 55926505) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(3-methylbenzoyl)amino]butanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(3-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55926505 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-[(3-methylbenzoyl)amino]butanoate |
| SMILES | Cc1cccc(C(=O)N[C@H](C(=O)OCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)C(C)C)c1 |
| InChI | InChI=1S/C29H26N2O6/c1-16(2)25(31-28(35)18-8-6-7-17(3)13-18)29(36)37-15-24(32)30-19-11-12-22-23(14-19)27(34)21-10-5-4-9-20(21)26(22)33/h4-14,16,25H,15H2,1-3H3,(H,30,32)(H,31,35)/t25-/m0/s1 |
| InChIKey | IZPLIHVVJSVZMF-VWLOTQADSA-N |
| XLogP | 3.71 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|