C22H26N2O7S — CID 55326461
butyl 4-[[2-[2-(benzenesulfonamido)propanoyloxy]acetyl]amino]benzoate (PubChem CID 55326461) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is butyl 4-[[2-[2-(benzenesulfonamido)propanoyloxy]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[2-(benzenesulfonamido)propanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55326461 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | butyl 4-[[2-[2-(benzenesulfonamido)propanoyloxy]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)C(C)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O7S/c1-3-4-14-30-22(27)17-10-12-18(13-11-17)23-20(25)15-31-21(26)16(2)24-32(28,29)19-8-6-5-7-9-19/h5-13,16,24H,3-4,14-15H2,1-2H3,(H,23,25) |
| InChIKey | VSVWADZRDKKSQY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|