C24H22N2O6S — CID 55927206
[2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate (PubChem CID 55927206) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55927206 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(benzenesulfonamido)propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1)C(=O)OCC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O6S/c1-17(26-33(30,31)21-10-6-3-7-11-21)24(29)32-16-22(27)18-12-14-20(15-13-18)25-23(28)19-8-4-2-5-9-19/h2-15,17,26H,16H2,1H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | VUSCKDWLOPWXSM-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |