C23H26N2O5 — CID 7571920
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamidopropanoate (PubChem CID 7571920) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamidopropanoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamidopropanoate |
|---|---|
| PubChem CID | 7571920 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] (2S)-2-benzamidopropanoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)[C@H](C)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-15(2)13-21(27)25-19-11-9-17(10-12-19)20(26)14-30-23(29)16(3)24-22(28)18-7-5-4-6-8-18/h4-12,15-16H,13-14H2,1-3H3,(H,24,28)(H,25,27)/t16-/m0/s1 |
| InChIKey | OVDUYAFOVMOYDF-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |