C19H19NO4 — CID 8884992
phenacyl (2S)-2-[(3-methylbenzoyl)amino]propanoate (PubChem CID 8884992) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is phenacyl (2S)-2-[(3-methylbenzoyl)amino]propanoate.
| Compound Name | phenacyl (2S)-2-[(3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8884992 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | phenacyl (2S)-2-[(3-methylbenzoyl)amino]propanoate |
| SMILES | Cc1cccc(C(=O)N[C@@H](C)C(=O)OCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO4/c1-13-7-6-10-16(11-13)18(22)20-14(2)19(23)24-12-17(21)15-8-4-3-5-9-15/h3-11,14H,12H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | AQGBASVZGVUELS-AWEZNQCLSA-N |
| XLogP | 2.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |