C21H23NO4 — CID 2593672
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] (2R)-2-benzamidopropanoate (PubChem CID 2593672) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] (2R)-2-benzamidopropanoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] (2R)-2-benzamidopropanoate |
|---|---|
| PubChem CID | 2593672 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] (2R)-2-benzamidopropanoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)[C@@H](C)NC(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C21H23NO4/c1-13-10-15(3)18(11-14(13)2)19(23)12-26-21(25)16(4)22-20(24)17-8-6-5-7-9-17/h5-11,16H,12H2,1-4H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | MJRSHEGXPKPTAQ-MRXNPFEDSA-N |
| XLogP | 3.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |