C27H27NO4 — CID 18226931
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-benzamido-3-phenylpropanoate (PubChem CID 18226931) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-benzamido-3-phenylpropanoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 18226931 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-benzamido-3-phenylpropanoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)CC(NC(=O)c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C27H27NO4/c1-18-14-20(3)23(15-19(18)2)25(29)17-32-26(30)16-24(21-10-6-4-7-11-21)28-27(31)22-12-8-5-9-13-22/h4-15,24H,16-17H2,1-3H3,(H,28,31) |
| InChIKey | VRXSOZNSTQUOJI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |