C30H27FN2O4 — CID 2111884
[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-benzamido-3-phenylpropanoate (PubChem CID 2111884) has the molecular formula C30H27FN2O4 and a molecular weight of 498.55 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-benzamido-3-phenylpropanoate.
| Compound Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 2111884 |
| Molecular Formula | C30H27FN2O4 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-benzamido-3-phenylpropanoate |
| SMILES | Cc1cc(C(=O)COC(=O)C[C@@H](NC(=O)c2ccccc2)c2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H27FN2O4/c1-20-17-26(21(2)33(20)25-15-13-24(31)14-16-25)28(34)19-37-29(35)18-27(22-9-5-3-6-10-22)32-30(36)23-11-7-4-8-12-23/h3-17,27H,18-19H2,1-2H3,(H,32,36)/t27-/m1/s1 |
| InChIKey | MAOOGHQHUHHWNC-HHHXNRCGSA-N |
| XLogP | 5.52 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|