C22H19F2NO4 — CID 2454735
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] benzoate (PubChem CID 2454735) has the molecular formula C22H19F2NO4 and a molecular weight of 399.39 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] benzoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 2454735 |
| Molecular Formula | C22H19F2NO4 |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] benzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccccc2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H19F2NO4/c1-14-12-19(20(26)13-28-21(27)16-6-4-3-5-7-16)15(2)25(14)17-8-10-18(11-9-17)29-22(23)24/h3-12,22H,13H2,1-2H3 |
| InChIKey | UKFKEXCFDDMZOS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|