C22H18BrF2NO4 — CID 2454700
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-bromobenzoate (PubChem CID 2454700) has the molecular formula C22H18BrF2NO4 and a molecular weight of 478.29 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-bromobenzoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 2454700 |
| Molecular Formula | C22H18BrF2NO4 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-bromobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cccc(Br)c2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H18BrF2NO4/c1-13-10-19(20(27)12-29-21(28)15-4-3-5-16(23)11-15)14(2)26(13)17-6-8-18(9-7-17)30-22(24)25/h3-11,22H,12H2,1-2H3 |
| InChIKey | YUNBVIASOHSJOX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|