C23H23NO5 — CID 7890141
[2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 7890141) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7890141 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | CCOc1ccc(-n2c(C)cc(C(=O)COC(=O)c3cccc(O)c3)c2C)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-4-28-20-10-8-18(9-11-20)24-15(2)12-21(16(24)3)22(26)14-29-23(27)17-6-5-7-19(25)13-17/h5-13,25H,4,14H2,1-3H3 |
| InChIKey | BNYPFJCXHDTTHT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|