C22H21NO5 — CID 7866659
[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 7866659) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 7866659 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)COC(=O)c3ccc(O)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H21NO5/c1-14-12-20(15(2)23(14)17-6-10-19(27-3)11-7-17)21(25)13-28-22(26)16-4-8-18(24)9-5-16/h4-12,24H,13H2,1-3H3 |
| InChIKey | UTZQYUXVTVORFK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|