C23H23NO6S — CID 2528452
[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 2528452) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528452 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)COC(=O)c3cccc(S(C)(=O)=O)c3)c2C)cc1 |
| InChI | InChI=1S/C23H23NO6S/c1-15-12-21(16(2)24(15)18-8-10-19(29-3)11-9-18)22(25)14-30-23(26)17-6-5-7-20(13-17)31(4,27)28/h5-13H,14H2,1-4H3 |
| InChIKey | VJLHDVUDXJVIQJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|