C22H21NO5S — CID 2528446
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 2528446) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2528446 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H21NO5S/c1-15-12-20(16(2)23(15)18-9-5-4-6-10-18)21(24)14-28-22(25)17-8-7-11-19(13-17)29(3,26)27/h4-13H,14H2,1-3H3 |
| InChIKey | DHQPCECPNAUZJJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|