C23H21NO4 — CID 71881431
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1,3-dihydro-2-benzofuran-5-carboxylate (PubChem CID 71881431) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1,3-dihydro-2-benzofuran-5-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1,3-dihydro-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 71881431 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1,3-dihydro-2-benzofuran-5-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc3c(c2)COC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H21NO4/c1-15-10-21(16(2)24(15)20-6-4-3-5-7-20)22(25)14-28-23(26)17-8-9-18-12-27-13-19(18)11-17/h3-11H,12-14H2,1-2H3 |
| InChIKey | USOWESKPARJBOV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|