C21H18BrNO4 — CID 2452741
[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 2452741) has the molecular formula C21H18BrNO4 and a molecular weight of 428.28 g/mol. Its IUPAC name is [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2452741 |
| Molecular Formula | C21H18BrNO4 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(O)cc2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrNO4/c1-13-11-19(14(2)23(13)17-7-5-16(22)6-8-17)20(25)12-27-21(26)15-3-9-18(24)10-4-15/h3-11,24H,12H2,1-2H3 |
| InChIKey | KVENDQCMJVUYMO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|