C21H16BrClN2O5 — CID 3597053
[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-4-nitrobenzoate (PubChem CID 3597053) has the molecular formula C21H16BrClN2O5 and a molecular weight of 491.73 g/mol. Its IUPAC name is [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 3597053 |
| Molecular Formula | C21H16BrClN2O5 |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | [2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc([N+](=O)[O-])cc2Cl)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrClN2O5/c1-12-9-18(13(2)24(12)15-5-3-14(22)4-6-15)20(26)11-30-21(27)17-8-7-16(25(28)29)10-19(17)23/h3-10H,11H2,1-2H3 |
| InChIKey | CVXDAVQUVRMQFW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|