C19H16BrN3O4 — CID 3924626
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone (PubChem CID 3924626) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
|---|---|
| PubChem CID | 3924626 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
| SMILES | Cc1cc(C(=O)COc2cccnc2[N+](=O)[O-])c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrN3O4/c1-12-10-16(13(2)22(12)15-7-5-14(20)6-8-15)17(24)11-27-18-4-3-9-21-19(18)23(25)26/h3-10H,11H2,1-2H3 |
| InChIKey | ALBKPPSPMZFIGJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|