C22H20FNO4 — CID 7892038
methyl 4-[3-[2-(2-fluorophenoxy)acetyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 7892038) has the molecular formula C22H20FNO4 and a molecular weight of 381.40 g/mol. Its IUPAC name is methyl 4-[3-[2-(2-fluorophenoxy)acetyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-(2-fluorophenoxy)acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 7892038 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | methyl 4-[3-[2-(2-fluorophenoxy)acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)COc3ccccc3F)c2C)cc1 |
| InChI | InChI=1S/C22H20FNO4/c1-14-12-18(20(25)13-28-21-7-5-4-6-19(21)23)15(2)24(14)17-10-8-16(9-11-17)22(26)27-3/h4-12H,13H2,1-3H3 |
| InChIKey | SBAZGYAHARHFJU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|