C22H22FNO4 — CID 110656344
2-(2,3-dimethoxyphenoxy)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 110656344) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenoxy)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(2,3-dimethoxyphenoxy)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 110656344 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-(2,3-dimethoxyphenoxy)-1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COc1cccc(OCC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)c1OC |
| InChI | InChI=1S/C22H22FNO4/c1-14-12-18(15(2)24(14)17-10-8-16(23)9-11-17)19(25)13-28-21-7-5-6-20(26-3)22(21)27-4/h5-12H,13H2,1-4H3 |
| InChIKey | OGCALDNVKHFYNL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|