C22H23NO4 — CID 110656323
2-(2,3-dimethoxyphenoxy)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 110656323) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenoxy)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-(2,3-dimethoxyphenoxy)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110656323 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-(2,3-dimethoxyphenoxy)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | COc1cccc(OCC(=O)c2cc(C)n(-c3ccccc3)c2C)c1OC |
| InChI | InChI=1S/C22H23NO4/c1-15-13-18(16(2)23(15)17-9-6-5-7-10-17)19(24)14-27-21-12-8-11-20(25-3)22(21)26-4/h5-13H,14H2,1-4H3 |
| InChIKey | OSZINCJDPHBMOF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|