C24H25NO4 — CID 7891367
[2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methoxybenzoate (PubChem CID 7891367) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methoxybenzoate.
| Compound Name | [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7891367 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)c1cc(C)n(-c2cc(C)cc(C)c2)c1C |
| InChI | InChI=1S/C24H25NO4/c1-15-10-16(2)12-19(11-15)25-17(3)13-21(18(25)4)22(26)14-29-24(27)20-8-6-7-9-23(20)28-5/h6-13H,14H2,1-5H3 |
| InChIKey | WYMBNYKTYULEDO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|