C26H29NO3 — CID 7224041
[2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-phenylbutanoate (PubChem CID 7224041) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-phenylbutanoate.
| Compound Name | [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7224041 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | [2-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (3R)-3-phenylbutanoate |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(C(=O)COC(=O)C[C@@H](C)c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C26H29NO3/c1-17-11-18(2)13-23(12-17)27-20(4)15-24(21(27)5)25(28)16-30-26(29)14-19(3)22-9-7-6-8-10-22/h6-13,15,19H,14,16H2,1-5H3/t19-/m1/s1 |
| InChIKey | JUSXDKHPZPSBRS-LJQANCHMSA-N |
| XLogP | 5.63 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|