C22H19F2NO3S — CID 7225144
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7225144) has the molecular formula C22H19F2NO3S and a molecular weight of 415.46 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7225144 |
| Molecular Formula | C22H19F2NO3S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | Cc1cc(C(=O)COC(=O)CSc2ccccc2F)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H19F2NO3S/c1-14-10-18(15(2)25(14)17-7-5-6-16(23)11-17)20(26)12-28-22(27)13-29-21-9-4-3-8-19(21)24/h3-11H,12-13H2,1-2H3 |
| InChIKey | UXSVLZJYFWAHPJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|