C20H24FN3O4S — CID 8580224
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 8580224) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8580224 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)OCC(=O)c1cc(C)n(-c2cccc(F)c2)c1C |
| InChI | InChI=1S/C20H24FN3O4S/c1-12-9-16(13(2)24(12)15-6-4-5-14(21)10-15)18(25)11-28-19(26)17(7-8-29-3)23-20(22)27/h4-6,9-10,17H,7-8,11H2,1-3H3,(H3,22,23,27)/t17-/m0/s1 |
| InChIKey | RAWBIPHLFKJGNP-KRWDZBQOSA-N |
| XLogP | 2.75 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|