C20H23FN2O5S — CID 55943711
[2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate (PubChem CID 55943711) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55943711 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [2-[1-(3-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)[C@@H]2CCCN2S(C)(=O)=O)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H23FN2O5S/c1-13-10-17(14(2)23(13)16-7-4-6-15(21)11-16)19(24)12-28-20(25)18-8-5-9-22(18)29(3,26)27/h4,6-7,10-11,18H,5,8-9,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | MGRDWYWRKREANL-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|