C25H25FN2O5S — CID 3407189
[2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 3407189) has the molecular formula C25H25FN2O5S and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3407189 |
| Molecular Formula | C25H25FN2O5S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [2-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-oxoethyl] 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)C2CCCN2S(=O)(=O)c2ccccc2F)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C25H25FN2O5S/c1-17-15-20(18(2)28(17)19-9-4-3-5-10-19)23(29)16-33-25(30)22-12-8-14-27(22)34(31,32)24-13-7-6-11-21(24)26/h3-7,9-11,13,15,22H,8,12,14,16H2,1-2H3 |
| InChIKey | AEZKXMBHMKLDKP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|