C19H19F2NO5S — CID 8581634
(3-fluoro-4-methoxyphenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 8581634) has the molecular formula C19H19F2NO5S and a molecular weight of 411.43 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 8581634 |
| Molecular Formula | C19H19F2NO5S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl (2S)-1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COc1ccc(COC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccccc2F)cc1F |
| InChI | InChI=1S/C19H19F2NO5S/c1-26-17-9-8-13(11-15(17)21)12-27-19(23)16-6-4-10-22(16)28(24,25)18-7-3-2-5-14(18)20/h2-3,5,7-9,11,16H,4,6,10,12H2,1H3/t16-/m0/s1 |
| InChIKey | MXYGBMIGFOZOHD-INIZCTEOSA-N |
| XLogP | 2.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |