C19H19Cl2NO4S — CID 4984288
benzyl 1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 4984288) has the molecular formula C19H19Cl2NO4S and a molecular weight of 428.34 g/mol. Its IUPAC name is benzyl 1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4984288 |
| Molecular Formula | C19H19Cl2NO4S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | benzyl 1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC2C(=O)OCc2ccccc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO4S/c1-13-10-18(16(21)11-15(13)20)27(24,25)22-9-5-8-17(22)19(23)26-12-14-6-3-2-4-7-14/h2-4,6-7,10-11,17H,5,8-9,12H2,1H3 |
| InChIKey | QDFCWKGUOBEBQC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |