C14H18ClNO4S — CID 79836493
methyl (2R)-1-(4-chloro-2-methylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 79836493) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is methyl (2R)-1-(4-chloro-2-methylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(4-chloro-2-methylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 79836493 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | methyl (2R)-1-(4-chloro-2-methylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C14H18ClNO4S/c1-10-9-11(15)6-7-13(10)21(18,19)16-8-4-3-5-12(16)14(17)20-2/h6-7,9,12H,3-5,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | RBHQPUPJBRZAGI-GFCCVEGCSA-N |
| XLogP | 2.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |